* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLUCOIMIDAZOLE |
English Synonyms: | GLUCOIMIDAZOLE |
MDL Number.: | MFCD00950204 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | c1cn2c(n1)[C@@H]([C@H]([C@@H]([C@H]2CO)O)O)O |
InChi: | InChI=1S/C8H12N2O4/c11-3-4-5(12)6(13)7(14)8-9-1-2-10(4)8/h1-2,4-7,11-14H,3H2/t4-,5-,6+,7-/m1/s1 |
InChiKey: | InChIKey=RZRDQZQPTISYKY-MVIOUDGNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.