* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | AQ 148 |
| CAS: | 178820-70-7 |
| English Synonyms: | AQ 148 |
| MDL Number.: | MFCD00951276 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@H](C[N@@+](C)(Cc2ccccc2)[N-]C(=O)c3ccccc3)O |
| InChi: | InChI=1S/C30H37N3O4/c1-30(2,3)37-29(36)31-26(20-23-14-8-5-9-15-23)27(34)22-33(4,21-24-16-10-6-11-17-24)32-28(35)25-18-12-7-13-19-25/h5-19,26-27,34H,20-22H2,1-4H3,(H,31,36)/t26-,27-,33+/m0/s1 |
| InChiKey: | InChIKey=CUQUROLDPALLNY-ZTMGNVKNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.