* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINAZOLIN-8-OL |
| CAS: | 7557-02-0 |
| English Synonyms: | 8-QUINAZOLINOL ; QUINAZOLIN-8-OL |
| MDL Number.: | MFCD00956156 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2cncnc2c(c1)O |
| InChi: | InChI=1S/C8H6N2O/c11-7-3-1-2-6-4-9-5-10-8(6)7/h1-5,11H |
| InChiKey: | InChIKey=LNNRQIKKDKDFRV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.