Molecular Structure:
CCD No.:CCD00182701
OTAVA-BB 1357737
Formula:C17 H27 N O3
MolWeight:293.404
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1357737 |
| English Synonyms： | OTAVA-BB 1357737 |
| MDL Number.： | MFCD00970626 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | CCCCCC(CC)NC(=O)C1C2CC(C1C(=O)O)C=C2 |
| InChi： | InChI=1S/C17H27NO3/c1-3-5-6-7-13(4-2)18-16(19)14-11-8-9-12(10-11)15(14)17(20)21/h8-9,11-15H,3-7,10H2,1-2H3,(H,18,19)(H,20,21) |
| InChiKey： | InChIKey=QWGATANCFNPWKY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
