* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FCHGROUP FCH762677 |
English Synonyms: | FCHGROUP FCH762677 |
MDL Number.: | MFCD00970858 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1)S(=O)(=O)NC(C)C#N |
InChi: | InChI=1S/C10H12N2O2S/c1-8-3-5-10(6-4-8)15(13,14)12-9(2)7-11/h3-6,9,12H,1-2H3 |
InChiKey: | InChIKey=NSOXWRRHPRLROF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.