* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 5-(1,4-THIAZINAN-4-YL)-3-(2-THIENYL)-1,2,4-TRIAZINE-6-CARBOXYLATE |
| English Synonyms: | ETHYL 5-(1,4-THIAZINAN-4-YL)-3-(2-THIENYL)-1,2,4-TRIAZINE-6-CARBOXYLATE |
| MDL Number.: | MFCD00974148 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)c1c(nc(nn1)c2cccs2)N3CCSCC3 |
| InChi: | InChI=1S/C14H16N4O2S2/c1-2-20-14(19)11-13(18-5-8-21-9-6-18)15-12(17-16-11)10-4-3-7-22-10/h3-4,7H,2,5-6,8-9H2,1H3 |
| InChiKey: | InChIKey=BPTCWVADOWZQOP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.