* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SILANDRIN |
| CAS: | 70815-32-6 |
| English Synonyms: | SILANDRIN |
| MDL Number.: | MFCD01075145 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | COc1cc(ccc1O)C2C(Oc3cc(ccc3O2)C4CC(=O)c5c(cc(cc5O4)O)O)CO |
| InChi: | InChI=1S/C25H22O9/c1-31-20-7-13(2-4-15(20)28)25-23(11-26)33-21-6-12(3-5-18(21)34-25)19-10-17(30)24-16(29)8-14(27)9-22(24)32-19/h2-9,19,23,25-29H,10-11H2,1H3 |
| InChiKey: | InChIKey=CRPGUMMYQABYES-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.