* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 7,8-DIFLUOROQUINOLINE |
CAS: | 145241-76-5 |
English Synonyms: | 7,8-DIFLUOROQUINOLINE |
MDL Number.: | MFCD01075229 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc2ccc(c(c2nc1)F)F |
InChi: | InChI=1S/C9H5F2N/c10-7-4-3-6-2-1-5-12-9(6)8(7)11/h1-5H |
InChiKey: | InChIKey=MTJUOHUSWWHAHJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.