Molecular Structure:
CCD No.:CCD00192696
SARCOSINE-D3 (METHYL-D3)
CAS No.:
118685-91-9
Formula:C3 H4 D3 N O2
MolWeight:92.1116
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | SARCOSINE-D3 (METHYL-D3) |
| CAS： | 118685-91-9 |
| English Synonyms： | N-METHYL-D3-GLYCINE ; SARCOSINE-D3 (METHYL-D3) |
| MDL Number.： | MFCD01075434 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | [2H]C([2H])([2H])NCC(=O)O |
| InChiKey： | InChIKey=null |
|
|
| Melting Point： | 208-212 DEG C |
| Comments： | MASS SHIFT: M+3 UNSPSC: 12142200 WGK: 3 |
| Information： | ISOTOPIC PURITY: 99 ATOM % D MW: 92.09 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
