* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (TRIMETHYLSILYL)ACETYLENE-13C2 |
CAS: | 285138-86-5 |
English Synonyms: | (TRIMETHYLSILYL)ACETYLENE-13C2 |
MDL Number.: | MFCD01075480 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C[Si](C)(C)[13C]#[13C][Si](C)(C)C |
InChi: | InChI=1S/C8H18Si2/c1-9(2,3)7-8-10(4,5)6/h1-6H3/i7+1,8+1 |
InChiKey: | InChIKey=ZDWYFWIBTZJGOR-BFGUONQLSA-N |
Property |
|
Boiling Point: | 53 DEG C |
Comments: | ASSAY METHOD: CP MASS SHIFT: M+2 RIDADR: UN 1993 3/PG 2 WGK: 3 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 100.20 BY ATOM % CALCULATION |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.