* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IODOACETAMIDE-15N |
CAS: | 287476-20-4 |
English Synonyms: | IODOACETAMIDE-15N |
MDL Number.: | MFCD01075619 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C(C(=O)[15NH2])I |
InChi: | InChI=1S/C2H4INO/c3-1-2(4)5/h1H2,(H2,4,5)/i4+1 |
InChiKey: | InChIKey=PGLTVOMIXTUURA-AZXPZELESA-N |
Property |
|
Melting Point: | 92-95 DEG C(LIT) |
Comments: | MASS SHIFT: M+1 RIDADR: UN 2811 6.1/PG 3 WGK: 3 |
Information: | ISOTOPIC PURITY: 98 ATOM % 15N MW: 185.94 BY ATOM % CALCULATION |
Safety information |
|
Symbol: | GHS06 GHS08 |
Signal word: | Danger |
Hazard statements: | H301-H317-H334 |
Precautionary statements: | P261-P280-P301 + P310-P342 + P311 |
hazard symbol: | T |
Risk Code: | R:25-42/43 |
Safe Code: | S:22-36/37-45 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.