* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHOSINE, [8-14C]- |
| English Synonyms: | XANTHOSINE, [8-14C]- |
| MDL Number.: | MFCD01075863 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | [14cH]1nc2c(n1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)[nH]c(=O)[nH]c2=O |
| InChi: | InChI=1S/C10H12N4O6/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19)/t3-,5-,6-,9-/m1/s1/i2+2 |
| InChiKey: | InChIKey=UBORTCNDUKBEOP-APZSIREWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.