* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBSCREEN-BB BB_NC-1475 |
English Synonyms: | IBSCREEN-BB BB_NC-1475 |
MDL Number.: | MFCD01081607 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C[C@]12CC[C@]3(C1)C(CCCC3(C)C)C2=O |
InChi: | InChI=1S/C14H22O/c1-12(2)6-4-5-10-11(15)13(3)7-8-14(10,12)9-13/h10H,4-9H2,1-3H3/t10?,13-,14-/m0/s1 |
InChiKey: | InChIKey=UBSJUMZOLIKMIE-RYQGGHCKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.