* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH325488 |
English Synonyms: | FCHGROUP FCH325488 |
MDL Number.: | MFCD01097298 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCc1ccc(cc1)S(=O)(=O)N(C)CC(=O)O |
InChi: | InChI=1S/C11H15NO4S/c1-3-9-4-6-10(7-5-9)17(15,16)12(2)8-11(13)14/h4-7H,3,8H2,1-2H3,(H,13,14) |
InChiKey: | InChIKey=OETZECBVBSLTPZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.