* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(3-ACETYL-2,3-DIHYDRO-1H-IMIDAZOL-1-YL)-1-ETHANONE |
CAS: | 10284-52-3 |
English Synonyms: | 1-(3-ACETYL-2,3-DIHYDRO-1H-IMIDAZOL-1-YL)-1-ETHANONE |
MDL Number.: | MFCD01111764 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(=O)N1CN(C=C1)C(=O)C |
InChi: | InChI=1S/C7H10N2O2/c1-6(10)8-3-4-9(5-8)7(2)11/h3-4H,5H2,1-2H3 |
InChiKey: | InChIKey=ZNGLGDQSOCSILT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.