* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH1113015 |
English Synonyms: | FCHGROUP FCH1113015 |
MDL Number.: | MFCD01142195 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1C2C1C3C=CC2C4C3C(=O)NC4=O |
InChi: | InChI=1S/C11H11NO2/c13-10-8-4-1-2-5(7-3-6(4)7)9(8)11(14)12-10/h1-2,4-9H,3H2,(H,12,13,14) |
InChiKey: | InChIKey=RUQZYIRKVNGHEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.