* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOFLOXYTHEPIN |
CAS: | 70931-18-9 |
English Synonyms: | ISOFLOXYTHEPIN |
MDL Number.: | MFCD01237582 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)c1ccc2c(c1)C(Cc3ccc(cc3S2)F)N4CCN(CC4)CCO |
InChi: | InChI=1S/C23H29FN2OS/c1-16(2)17-4-6-22-20(13-17)21(26-9-7-25(8-10-26)11-12-27)14-18-3-5-19(24)15-23(18)28-22/h3-6,13,15-16,21,27H,7-12,14H2,1-2H3 |
InChiKey: | InChIKey=XDBMBHVYXPBOPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.