* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ISOGRISAL 7 C |
| CAS: | 67923-83-5 |
| EnglishSynonyms: | ISOGRISAL 7 C |
| pro_mdlNumber: | MFCD01310374 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | CCOC(CCCCCC(C)C)OCC |
| InChi: | InChI=1S/C13H28O2/c1-5-14-13(15-6-2)11-9-7-8-10-12(3)4/h12-13H,5-11H2,1-4H3 |
| InChiKey: | InChIKey=UAARUIRTLPTVEA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.