Molecular Structure:
CCD No.:CCD00207107
FLUNISOLIDE-D6
Formula:C24 H25 D6 F O6
MolWeight:440.538
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | FLUNISOLIDE-D6 |
| English Synonyms： | FLUNISOLIDE-D6 |
| MDL Number.： | MFCD01310764 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | [2H]C([2H])([2H])C1(O[C@@H]2C[C@H]3[C@@H]4C[C@@H](C5=CC(=O)C=C[C@@]5([C@H]4[C@H](C[C@@]3([C@@]2(O1)C(=O)CO)C)O)C)F)C([2H])([2H])[2H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
