* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GR(ACAC)3, BENZAMIDE |
English Synonyms: | GR(ACAC)3, BENZAMIDE |
MDL Number.: | MFCD01311004 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | C/C(=C/C(=O)C)/O[Cr](O/C(=C\C(=O)C)/C)O/C(=C\C(=O)C)/C.c1ccc(cc1)C(=O)N |
InChi: | InChI=1S/C7H7NO.3C5H8O2.Cr/c8-7(9)6-4-2-1-3-5-6;3*1-4(6)3-5(2)7;/h1-5H,(H2,8,9);3*3,6H,1-2H3;/q;;;;+3/p-3/b;3*4-3-; |
InChiKey: | InChIKey=BUIYORMIAIUGFB-XUHIWKAKSA-K |
* If the product has intellectual property rights, a license granted is must or contact us.