* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GEMFIBROZIL, [CARBOXYL-14C]- |
English Synonyms: | GEMFIBROZIL, [CARBOXYL-14C]- |
MDL Number.: | MFCD01311104 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1ccc(c(c1)OCCCC(C)(C)[14C](=O)O)C |
InChi: | InChI=1S/C15H22O3/c1-11-6-7-12(2)13(10-11)18-9-5-8-15(3,4)14(16)17/h6-7,10H,5,8-9H2,1-4H3,(H,16,17)/i14+2 |
InChiKey: | InChIKey=HEMJJKBWTPKOJG-HKGQFRNVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.