* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMOHYPOXANTHINE |
| CAS: | 56046-36-7 |
| English Synonyms: | 8-BROMO-6,7-DIHYDRO-1H-PURIN-6-ONE ; 8-BROMOHYPOXANTHINE |
| MDL Number.: | MFCD01317991 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1[nH]c(=O)c2c(n1)nc([nH]2)Br |
| InChi: | InChI=1S/C5H3BrN4O/c6-5-9-2-3(10-5)7-1-8-4(2)11/h1H,(H2,7,8,9,10,11) |
| InChiKey: | InChIKey=IZBNLPSFAGAYBD-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.