* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EPHEDRINE-BORANE |
| CAS: | 126874-38-2 |
| English Synonyms: | EPHEDRINE-BORANE |
| MDL Number.: | MFCD01318523 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | B.CC(C(c1ccccc1)O)NC |
| InChi: | InChI=1S/C10H15NO.BH3/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-12H,1-2H3;1H3 |
| InChiKey: | InChIKey=OGWVPTMLJBFXTF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.