* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FA-PHE-LYS-OH HCL |
English Synonyms: | FA-PHE-LYS-OH HCL |
MDL Number.: | MFCD01318851 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)/C=C/c2ccco2.Cl |
InChi: | InChI=1S/C22H27N3O5.ClH/c23-13-5-4-10-18(22(28)29)25-21(27)19(15-16-7-2-1-3-8-16)24-20(26)12-11-17-9-6-14-30-17;/h1-3,6-9,11-12,14,18-19H,4-5,10,13,15,23H2,(H,24,26)(H,25,27)(H,28,29);1H/b12-11+;/t18-,19-;/m0./s1 |
InChiKey: | InChIKey=SJGDCSJGIDIZHJ-RPQBTBOMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.