* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 5-(1-NAPHTHYL)-5-OXOVALERATE |
| CAS: | 40335-93-1 |
| English Synonyms: | ETHYL 5-(1-NAPHTHYL)-5-OXOVALERATE |
| MDL Number.: | MFCD01320263 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)CCCC(=O)c1cccc2c1cccc2 |
| InChi: | InChI=1S/C17H18O3/c1-2-20-17(19)12-6-11-16(18)15-10-5-8-13-7-3-4-9-14(13)15/h3-5,7-10H,2,6,11-12H2,1H3 |
| InChiKey: | InChIKey=OVJXJVBYTCRUBA-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.