* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 8-(4-BIPHENYL)-8-OXOOCTANOATE |
| CAS: | 362669-47-4 |
| English Synonyms: | ETHYL 8-(4-BIPHENYL)-8-OXOOCTANOATE |
| MDL Number.: | MFCD01320308 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)CCCCCCC(=O)c1ccc(cc1)c2ccccc2 |
| InChi: | InChI=1S/C22H26O3/c1-2-25-22(24)13-9-4-3-8-12-21(23)20-16-14-19(15-17-20)18-10-6-5-7-11-18/h5-7,10-11,14-17H,2-4,8-9,12-13H2,1H3 |
| InChiKey: | InChIKey=AOPVUBIDRJQHMV-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.