* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 5-OXOOCTANOATE |
| CAS: | 5205-40-3 |
| English Synonyms: | ETHYL 5-OXOOCTANOATE |
| MDL Number.: | MFCD01320348 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCCC(=O)CCCC(=O)OCC |
| InChi: | InChI=1S/C10H18O3/c1-3-6-9(11)7-5-8-10(12)13-4-2/h3-8H2,1-2H3 |
| InChiKey: | InChIKey=PNHVXYJIXFZRGA-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.