* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-ALLYLINDENE |
| CAS: | 2294-87-3 |
| English Synonyms: | 3-(PROP-2-EN-1-YL)-1H-INDENE ; 3-ALLYLINDENE ; 3-ALLYL-1H-INDENE |
| MDL Number.: | MFCD01320535 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C=CCC1=CCc2c1cccc2 |
| InChi: | InChI=1S/C12H12/c1-2-5-10-8-9-11-6-3-4-7-12(10)11/h2-4,6-8H,1,5,9H2 |
| InChiKey: | InChIKey=XWSAOGCYQVJZNW-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.