* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB022868 |
| English Synonyms: | VITAS-BB TBB022868 |
| MDL Number.: | MFCD01337710 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COC(=O)C1=C(NC(=O)C2=CC=CC(OC)=C2)SC2=C1CCC(C)C2 |
| InChi: | InChI=1S/C19H21NO4S/c1-11-7-8-14-15(9-11)25-18(16(14)19(22)24-3)20-17(21)12-5-4-6-13(10-12)23-2/h4-6,10-11H,7-9H2,1-3H3,(H,20,21) |
| InChiKey: | InChIKey=FFRHQVKBRQKNLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.