* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB017353 |
| English Synonyms: | VITAS-BB TBB017353 |
| MDL Number.: | MFCD01337789 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC\C(=N/NC(=O)C1=CC=CC=C1Br)C1=C(O)C=CC=C1 |
| InChi: | InChI=1S/C16H15BrN2O2/c1-2-14(12-8-4-6-10-15(12)20)18-19-16(21)11-7-3-5-9-13(11)17/h3-10,20H,2H2,1H3,(H,19,21)/b18-14+ |
| InChiKey: | InChIKey=QHPRJZHLSDBCAU-NBVRZTHBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.