* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB023641 |
| English Synonyms: | VITAS-BB TBB023641 |
| MDL Number.: | MFCD01337854 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCCC1CCC2=C(C1)SC(NC(=O)C1=CC=C(C)C(=C1)[N+]([O-])=O)=C2C(N)=O |
| InChi: | InChI=1S/C20H23N3O4S/c1-3-4-12-6-8-14-16(9-12)28-20(17(14)18(21)24)22-19(25)13-7-5-11(2)15(10-13)23(26)27/h5,7,10,12H,3-4,6,8-9H2,1-2H3,(H2,21,24)(H,22,25) |
| InChiKey: | InChIKey=WWUZEGMSIIDGCM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.