* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024509 |
English Synonyms: | VITAS-BB TBB024509 |
MDL Number.: | MFCD01338453 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1=C(NC(=O)C2=CC(=CC=C2Cl)[N+]([O-])=O)SC2=C1CCC(CC)C2 |
InChi: | InChI=1S/C20H21ClN2O5S/c1-3-11-5-7-13-16(9-11)29-19(17(13)20(25)28-4-2)22-18(24)14-10-12(23(26)27)6-8-15(14)21/h6,8,10-11H,3-5,7,9H2,1-2H3,(H,22,24) |
InChiKey: | InChIKey=CJBNLGBOAUHUJN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.