* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB027682 |
| English Synonyms: | VITAS-BB TBB027682 |
| MDL Number.: | MFCD01339620 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CCC1CCC2=C(C1)SC(NC(=O)C1=CC(=C(C)C(=C1)[N+]([O-])=O)[N+]([O-])=O)=C2C#N |
| InChi: | InChI=1S/C19H18N4O5S/c1-3-11-4-5-13-14(9-20)19(29-17(13)6-11)21-18(24)12-7-15(22(25)26)10(2)16(8-12)23(27)28/h7-8,11H,3-6H2,1-2H3,(H,21,24) |
| InChiKey: | InChIKey=SVDXRMYVLYUDRP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.