* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB017788 |
| English Synonyms: | VITAS-BB TBB017788 |
| MDL Number.: | MFCD01341712 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC1CCC2=C(C1)SC(NC(=O)C1=C3C=CC=CC3=NC(=C1)C1=CC=C(C)C=C1)=C2C(N)=O |
| InChi: | InChI=1S/C27H25N3O2S/c1-15-7-10-17(11-8-15)22-14-20(18-5-3-4-6-21(18)29-22)26(32)30-27-24(25(28)31)19-12-9-16(2)13-23(19)33-27/h3-8,10-11,14,16H,9,12-13H2,1-2H3,(H2,28,31)(H,30,32) |
| InChiKey: | InChIKey=TXSZTSKJZYBUDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.