* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB022973 |
English Synonyms: | VITAS-BB TBB022973 |
MDL Number.: | MFCD01342826 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | COC1=CC=C(CC(=O)NNC(=O)NC2=CC(Cl)=C(Cl)C=C2)C=C1 |
InChi: | InChI=1S/C16H15Cl2N3O3/c1-24-12-5-2-10(3-6-12)8-15(22)20-21-16(23)19-11-4-7-13(17)14(18)9-11/h2-7,9H,8H2,1H3,(H,20,22)(H2,19,21,23) |
InChiKey: | InChIKey=DKRWHANAGZGZDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.