* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB022520 |
English Synonyms: | VITAS-BB TBB022520 |
MDL Number.: | MFCD01343361 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCCC1CCC2=C(C1)SC(NC(=O)C1=CC=C(C=C1Cl)[N+]([O-])=O)=C2C(N)=O |
InChi: | InChI=1S/C19H20ClN3O4S/c1-2-3-10-4-6-13-15(8-10)28-19(16(13)17(21)24)22-18(25)12-7-5-11(23(26)27)9-14(12)20/h5,7,9-10H,2-4,6,8H2,1H3,(H2,21,24)(H,22,25) |
InChiKey: | InChIKey=WRPFIBCPCDVJGR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.