* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB022356 |
English Synonyms: | VITAS-BB TBB022356 |
MDL Number.: | MFCD01343590 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COC(=O)C1=C(C)C(C(N)=O)=C(NC(=O)C2=C3C=CC=CC3=NC(=C2)C2=CC=C(Cl)S2)S1 |
InChi: | InChI=1S/C22H16ClN3O4S2/c1-10-17(19(24)27)21(32-18(10)22(29)30-2)26-20(28)12-9-14(15-7-8-16(23)31-15)25-13-6-4-3-5-11(12)13/h3-9H,1-2H3,(H2,24,27)(H,26,28) |
InChiKey: | InChIKey=HUCMXRPHZGGEPE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.