* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB017412 |
| English Synonyms: | VITAS-BB TBB017412 |
| MDL Number.: | MFCD01343671 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCCCC(=O)N\N=C(/CC)C1=CC=C(C)C=C1 |
| InChi: | InChI=1S/C17H26N2O/c1-4-6-7-8-9-17(20)19-18-16(5-2)15-12-10-14(3)11-13-15/h10-13H,4-9H2,1-3H3,(H,19,20)/b18-16+ |
| InChiKey: | InChIKey=QCLQAMCYIPJDGC-FBMGVBCBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.