* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB017451 |
English Synonyms: | VITAS-BB TBB017451 |
MDL Number.: | MFCD01348931 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | ClC1=CC=C(OCC(=O)N\N=C(/C2=CC=CC=C2)C2=NC=CC=C2)C=C1 |
InChi: | InChI=1S/C20H16ClN3O2/c21-16-9-11-17(12-10-16)26-14-19(25)23-24-20(15-6-2-1-3-7-15)18-8-4-5-13-22-18/h1-13H,14H2,(H,23,25)/b24-20+ |
InChiKey: | InChIKey=KMXJYWKKIUKUTO-HIXSDJFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.