* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024711 |
English Synonyms: | VITAS-BB TBB024711 |
MDL Number.: | MFCD01348938 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1=CC(=CC=C1[N+]([O-])=O)C(=O)N\N=C1\CC2C=CCC12 |
InChi: | InChI=1S/C15H15N3O3/c1-9-7-11(5-6-14(9)18(20)21)15(19)17-16-13-8-10-3-2-4-12(10)13/h2-3,5-7,10,12H,4,8H2,1H3,(H,17,19)/b16-13- |
InChiKey: | InChIKey=WMVXJPQTXNTPMV-SSZFMOIBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.