* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB023721 |
English Synonyms: | VITAS-BB TBB023721 |
MDL Number.: | MFCD01349900 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | COC(=O)N\N=C(\C)C1=CC=C(NC(=O)C2CCCCC2)C=C1 |
InChi: | InChI=1S/C17H23N3O3/c1-12(19-20-17(22)23-2)13-8-10-15(11-9-13)18-16(21)14-6-4-3-5-7-14/h8-11,14H,3-7H2,1-2H3,(H,18,21)(H,20,22)/b19-12- |
InChiKey: | InChIKey=MTPZJSBHJQKCFA-UNOMPAQXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.