* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB017463 |
English Synonyms: | VITAS-BB TBB017463 |
MDL Number.: | MFCD01350248 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | ClC1=CC=C(OCC(=O)NN=C2CCC(CC2)C2=CC=CC=C2)C=C1 |
InChi: | InChI=1S/C20H21ClN2O2/c21-17-8-12-19(13-9-17)25-14-20(24)23-22-18-10-6-16(7-11-18)15-4-2-1-3-5-15/h1-5,8-9,12-13,16H,6-7,10-11,14H2,(H,23,24) |
InChiKey: | InChIKey=RGMFQACRWWKYFO-PYCFMQQDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.