* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB022170 |
English Synonyms: | VITAS-BB TBB022170 |
MDL Number.: | MFCD01350863 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COC(=O)C1=C(NC(=O)C2CCCCC2)SC(C)=C1C |
InChi: | InChI=1S/C15H21NO3S/c1-9-10(2)20-14(12(9)15(18)19-3)16-13(17)11-7-5-4-6-8-11/h11H,4-8H2,1-3H3,(H,16,17) |
InChiKey: | InChIKey=BFSIOOWUTZHXGI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.