* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB017059 |
English Synonyms: | VITAS-BB TBB017059 |
MDL Number.: | MFCD01350936 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | [O-][N+](=O)C1=CC=C(CC(=O)N\N=C\C2=CC3=C(OCO3)C=C2Br)C=C1 |
InChi: | InChI=1S/C16H12BrN3O5/c17-13-7-15-14(24-9-25-15)6-11(13)8-18-19-16(21)5-10-1-3-12(4-2-10)20(22)23/h1-4,6-8H,5,9H2,(H,19,21)/b18-8+ |
InChiKey: | InChIKey=YLRVHRMFXSHZTB-QGMBQPNBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.