* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB017507 |
English Synonyms: | VITAS-BB TBB017507 |
MDL Number.: | MFCD01354414 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC\C(=N/NC(=O)C1=CC=C(Cl)C(Cl)=C1)C1=C(O)C=CC=C1 |
InChi: | InChI=1S/C16H14Cl2N2O2/c1-2-14(11-5-3-4-6-15(11)21)19-20-16(22)10-7-8-12(17)13(18)9-10/h3-9,21H,2H2,1H3,(H,20,22)/b19-14+ |
InChiKey: | InChIKey=PMLCNGUQYVRKNG-XMHGGMMESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.