* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB022321 |
| English Synonyms: | VITAS-BB TBB022321 |
| MDL Number.: | MFCD01355440 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)C1CCC2=C(C1)SC(NC(=O)C1=C3C=CC=CC3=NC(=C1)C1=CC=C(Cl)S1)=C2C(N)=O |
| InChi: | InChI=1S/C27H26ClN3O2S2/c1-27(2,3)14-8-9-16-21(12-14)35-26(23(16)24(29)32)31-25(33)17-13-19(20-10-11-22(28)34-20)30-18-7-5-4-6-15(17)18/h4-7,10-11,13-14H,8-9,12H2,1-3H3,(H2,29,32)(H,31,33) |
| InChiKey: | InChIKey=KGCZYLJOADLBOO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.