* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB023423 |
| English Synonyms: | VITAS-BB TBB023423 |
| MDL Number.: | MFCD01355597 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCC(C)(C)C1CCC2=C(C1)SC(NC(=O)C1=CC=CC=C1Br)=C2C(N)=O |
| InChi: | InChI=1S/C21H25BrN2O2S/c1-4-21(2,3)12-9-10-14-16(11-12)27-20(17(14)18(23)25)24-19(26)13-7-5-6-8-15(13)22/h5-8,12H,4,9-11H2,1-3H3,(H2,23,25)(H,24,26) |
| InChiKey: | InChIKey=YQVFEEFBFDXPNT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.