* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB018615 |
| English Synonyms: | VITAS-BB TBB018615 |
| MDL Number.: | MFCD01356605 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | ClC1=CC=C(OCCCC(=O)N\N=C\C2=C3C=CC=CC3=CC=C2)C(Cl)=C1 |
| InChi: | InChI=1S/C21H18Cl2N2O2/c22-17-10-11-20(19(23)13-17)27-12-4-9-21(26)25-24-14-16-7-3-6-15-5-1-2-8-18(15)16/h1-3,5-8,10-11,13-14H,4,9,12H2,(H,25,26)/b24-14+ |
| InChiKey: | InChIKey=BWIWYKFSXKFHAZ-ZVHZXABRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.