* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB017545 |
| English Synonyms: | VITAS-BB TBB017545 |
| MDL Number.: | MFCD01357172 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCN(CC)C1=CC(O)=C(\C=N\NC(=O)COC2=CC(Cl)=C(Cl)C=C2Cl)C=C1 |
| InChi: | InChI=1S/C19H20Cl3N3O3/c1-3-25(4-2)13-6-5-12(17(26)7-13)10-23-24-19(27)11-28-18-9-15(21)14(20)8-16(18)22/h5-10,26H,3-4,11H2,1-2H3,(H,24,27)/b23-10+ |
| InChiKey: | InChIKey=WLZKFOZZUXLCKR-AUEPDCJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.