* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB023356 |
English Synonyms: | VITAS-BB TBB023356 |
MDL Number.: | MFCD01359141 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | OC(=O)C1C2OC(C=C2)C1C(=O)NC1=CC=C(F)C(=C1)[N+]([O-])=O |
InChi: | InChI=1S/C14H11FN2O6/c15-7-2-1-6(5-8(7)17(21)22)16-13(18)11-9-3-4-10(23-9)12(11)14(19)20/h1-5,9-12H,(H,16,18)(H,19,20) |
InChiKey: | InChIKey=XGHKLCSMNZGIHH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.